CAS 426-79-9
:Tetraphenylphosphonium tetrafluoroborate
Description:
Tetraphenylphosphonium tetrafluoroborate is an ionic compound characterized by its distinct structure and properties. It consists of a tetraphenylphosphonium cation (Ph4P+) and a tetrafluoroborate anion (BF4-). The tetraphenylphosphonium cation features a phosphorus atom bonded to four phenyl groups, which contributes to its stability and solubility in organic solvents. This compound is typically a white crystalline solid at room temperature and is known for its high thermal stability. It is often used as a phase transfer catalyst and in various organic synthesis reactions due to its ability to facilitate the transfer of ions between different phases. Additionally, tetraphenylphosphonium tetrafluoroborate is non-hygroscopic, making it suitable for applications in dry environments. Its ionic nature imparts unique electrochemical properties, making it of interest in studies related to ionic liquids and electrochemistry. Overall, this compound is valued in both academic and industrial settings for its versatility and effectiveness in facilitating chemical reactions.
Formula:C24H20P·BF4
InChI:InChI=1S/C24H20P.BF4/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3,4)5/h1-20H;/q+1;-1
InChI key:InChIKey=MAJBFAYVSDYMQG-UHFFFAOYSA-N
SMILES:[P+](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[B+3]([F-])([F-])([F-])[F-]
Synonyms:- Phosphonium, tetraphenyl-, tetrafluoroborate(1-)
- Borate(1-), tetrafluoro-, tetraphenylphosphonium
- Phosphonium, tetraphenyl-, tetrafluoroborate(1-) (1:1)
- Tetraphenylphosphonium fluoborate
- Tetraphenylphosphonium tetrafluoroborate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Tetraphenylphosphonium tetrafluoroborate
CAS:Formula:C24H20BF4PPurity:98%Color and Shape:SolidMolecular weight:426.1940Tetrakis(phenyl)phosphonium tetrafluoroborate
CAS:Tetrakis(phenyl)phosphonium tetrafluoroboratePurity:≥95%Molecular weight:426.19g/molTetraphenylphosphonium Tetrafluoroborate
CAS:Tetraphenylphosphonium Tetrafluoroborate is an inorganic compound that has electron-donating aromatic hydrocarbon and hydrogen chloride functionalities. It is a colorless, oily liquid with a pungent odor. Tetraphenylphosphonium Tetrafluoroborate is soluble in organic solvents such as chloroform, ether, benzene, and carbon tetrachloride. Tetraphenylphosphonium Tetrafluoroborate can be used to prepare oil-in-water emulsions and can act as a diluent for other substances. The molecule has been shown to react with aliphatic hydrocarbons such as hexane to form anions like cyanate. It also reacts with transition metal ions such as copper(II) ions to produce polyenes.Formula:C24H20BF4PPurity:Min. 95%Molecular weight:426.19 g/mol


