CAS 42607-20-5

2,2-Dimethyl-4-thiazolidinecarboxylic acid

Description:

2,2-Dimethyl-4-thiazolidinecarboxylic acid is an organic compound characterized by its thiazolidine ring structure, which incorporates a sulfur atom and a carboxylic acid functional group. This compound features two methyl groups attached to the second carbon of the thiazolidine ring, contributing to its unique properties. It is typically a white to off-white crystalline solid, soluble in polar solvents due to the presence of the carboxylic acid group. The thiazolidine ring provides a degree of rigidity, influencing its reactivity and interactions with other molecules. This compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential biological activities and applications in synthesizing other chemical entities. Its CAS number, 42607-20-5, allows for easy identification in chemical databases and literature. As with many thiazolidine derivatives, it may exhibit interesting pharmacological properties, making it a subject of research in drug development and related studies.

Formula: C₆H₁₁NO₂S

InChI: InChI=1S/C6H11NO2S/c1-6(2)7-4(3-10-6)5(8)9/h4,7H,3H2,1-2H3,(H,8,9)

InChI key: InChIKey=OCQICQZUUHJWGZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1NC(C)(C)SC1

Synonyms:

• 2,2-Dimethyl-1,3-thiazolidine-4-carboxylic acid
• 2,2-Dimethyl-4-thiazolidinecarboxylic acid
• 4-Thiazolidinecarboxylic acid, 2,2-dimethyl-
• 2,2-Dimethylthiazolidine-4-carboxylic acid

2,2'-DIMETHYL-THIAZOLIDINE-4-CARBOXYLIC ACID

CAS: 42607-20-5

Formula: C₆H₁₁NO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.2220

Ref: IN-DA00CVHX

2,2-Dimethylthiazolidine-4-carboxylic acid

CAS: 42607-20-5

2,2-Dimethylthiazolidine-4-carboxylic acid

Purity: 95%

Molecular weight: 161.22g/mol

Ref: 54-OR92486

2,2-Dimethylthiazolidine-4-carboxylic acid

CAS: 42607-20-5

Purity: 95%

Molecular weight: 161.2200012

Ref: 10-F686881

2,2-Dimethylthiazolidine-4-carboxylic Acid

Controlled Product

CAS: 42607-20-5

Formula: C₆H₁₁NO₂S

Color and Shape: Neat

Molecular weight: 161.222

Ref: TR-D481668