CAS 42607-21-6

2-Phenylthiazolidine-4-carboxylic acid

Description:

2-Phenylthiazolidine-4-carboxylic acid, with the CAS number 42607-21-6, is an organic compound characterized by its thiazolidine ring structure, which incorporates both a phenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid. The thiazolidine ring contributes to its stability and reactivity, making it of interest in various chemical syntheses and biological applications. It may participate in reactions typical of carboxylic acids, such as esterification or amidation, and can also engage in nucleophilic substitutions due to the presence of the thiazolidine moiety. Additionally, compounds like 2-Phenylthiazolidine-4-carboxylic acid may exhibit biological activity, which can be explored in medicinal chemistry and drug development. Its specific characteristics, including melting point, boiling point, and spectral data, would be determined through experimental methods and can vary based on purity and environmental conditions.

Formula: C₁₀H₁₁NO₂S

InChI: InChI=1S/C10H11NO2S/c12-10(13)8-6-14-9(11-8)7-4-2-1-3-5-7/h1-5,8-9,11H,6H2,(H,12,13)

InChI key: InChIKey=AZDYQBFYMBALBY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1NC(SC1)C2=CC=CC=C2

Synonyms:

• 2-Phenyl-4-thiazolidinecarboxylic acid
• 2-Phenylthiazolidine-4-carboxylic acid
• 4-Thiazolidinecarboxylic acid, 2-phenyl-
• NSC 522094

2-Phenyl-1,3-thiazolane-4-carboxylic acid

CAS: 42607-21-6

Formula: C₁₀H₁₁NO₂S

Purity: %

Color and Shape: Solid

Molecular weight: 209.2648

Ref: IN-DA00BY5K

(4R)-2-Phenylthiazolidine-4-carboxylic acid

CAS: 42607-21-6

(4R)-2-Phenylthiazolidine-4-carboxylic acid

Purity: 95%

Molecular weight: 209.26g/mol

Ref: 54-OR300864

2-Phenyl-1,3-thiazolidine-4-carboxylic acid

CAS: 42607-21-6

2-Phenyl-1,3-thiazolidine-4-carboxylic acid is a thiourea that can be synthesized by the ring opening of an oxazolidinone. It has been shown to have potent cytotoxicity against prostate cancer cells and is used in the synthesis of chalcone and cellulose derivatives. 2-Phenyl-1,3-thiazolidine-4-carboxylic acid has also been shown to react with olefins to form enantiopure products. The reaction products are known for their anti-cancer properties.

Formula: C₁₀H₁₁NO₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 209.27 g/mol

Ref: 3D-FP124339