
CAS 42607-90-9
:29-[(Tetrahydro-2H-pyran-2-yl)oxy]-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol
Description:
The chemical substance known as "29-[(Tetrahydro-2H-pyran-2-yl)oxy]-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol," with the CAS number 42607-90-9, is a complex organic compound characterized by a long-chain structure featuring multiple ether linkages and a hydroxyl group. This compound belongs to the class of polyethers, which are known for their unique properties, including low toxicity and good solubility in various solvents. The presence of the tetrahydro-2H-pyran moiety contributes to its stability and potential reactivity, while the long carbon chain enhances its hydrophobic characteristics. Such compounds are often investigated for applications in surfactants, emulsifiers, and as potential drug delivery systems due to their biocompatibility and ability to form micelles. The structural complexity and functional groups present in this molecule suggest potential utility in various chemical and pharmaceutical applications, although specific biological activities and interactions would require further empirical investigation.
Formula:C25H50O12
InChI:InChI=1S/C25H50O12/c26-4-6-27-7-8-28-9-10-29-11-12-30-13-14-31-15-16-32-17-18-33-19-20-34-21-22-35-23-24-37-25-3-1-2-5-36-25/h25-26H,1-24H2
InChI key:InChIKey=KBKRADAZDQNCLS-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)C1CCCCO1
Synonyms:- 29-[(Tetrahydro-2H-pyran-2-yl)oxy]-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol
- 3,6,9,12,15,18,21,24,27-Nonaoxanonacosan-1-ol, 29-[(tetrahydro-2H-pyran-2-yl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
