CAS 4263-93-8

2-hydroxy-4-phenylbutanoic acid

Description:

2-Hydroxy-4-phenylbutanoic acid, also known as phenylbutyric acid, is an organic compound characterized by its carboxylic acid functional group and a hydroxyl group attached to a butanoic acid backbone. This compound features a phenyl group at the 4-position, which contributes to its aromatic properties. It is typically a white to off-white crystalline solid that is soluble in organic solvents and has limited solubility in water. The presence of both the hydroxyl and carboxylic acid groups allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. 2-Hydroxy-4-phenylbutanoic acid has been studied for its potential applications in pharmaceuticals and as a biochemical probe due to its structural features. Its CAS number, 4263-93-8, is used for identification in chemical databases. As with many organic acids, it may exhibit acidic behavior in solution, contributing to its role in various chemical reactions and biological processes.

Formula: C₁₀H₁₂O₃

InChI: InChI=1/C10H12O3/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h1-5,9,11H,6-7H2,(H,12,13)

SMILES: c1ccc(cc1)CCC(C(=O)O)O

Synonyms:

• Benzenebutanoic Acid, Alpha-Hydroxy-

Benzenebutanoic acid, a-hydroxy-

CAS: 4263-93-8

Formula: C₁₀H₁₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 180.2005

Ref: IN-DA0071SA

2-Hydroxy-4-phenylbutanoic acid

CAS: 4263-93-8

2-Hydroxy-4-phenylbutanoic acid

Purity: 97%

Molecular weight: 180.2g/mol

Ref: 54-OR1055859

2-Hydroxy-4-phenylbutanoic acid

CAS: 4263-93-8

2-Hydroxy-4-phenylbutanoic acid is an aliphatic hydrocarbon that is used for the synthesis of chiral compounds. It inhibits enzymes such as esterases, transferases, and oxidoreductases. 2-Hydroxy-4-phenylbutanoic acid also catalyzes the Friedel-Crafts reaction. This chemical has been shown to be a stereoselective enzyme inhibitor, which may be useful in asymmetric synthesis.

Formula: C₁₀H₁₂O₃

Purity: Min. 95%

Molecular weight: 180.2 g/mol

Ref: 3D-EAA26393