CAS 4264-35-1

1-(1H-indol-2-yl)ethanone

Description:

1-(1H-indol-2-yl)ethanone, also known as indole-2-acetophenone, is an organic compound characterized by its indole structure fused with an acetophenone moiety. This compound features a carbonyl group (C=O) adjacent to an indole ring, which contributes to its unique chemical properties. It typically appears as a solid or crystalline substance and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. The presence of the indole ring imparts aromatic characteristics, making it a potential candidate for various applications in pharmaceuticals and organic synthesis. Its reactivity can be attributed to the electrophilic nature of the carbonyl group, allowing it to participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, 1-(1H-indol-2-yl)ethanone may exhibit biological activity, which has drawn interest in medicinal chemistry for the development of new therapeutic agents. Overall, this compound serves as an important building block in organic chemistry and drug development.

Formula: C₁₀H₉NO

InChI: InChI=1/C10H9NO/c1-7(12)10-6-8-4-2-3-5-9(8)11-10/h2-6,11H,1H3

SMILES: CC(=O)c1cc2ccccc2[nH]1

Synonyms:

• ethanone, 1-(1H-indol-2-yl)-

2-Acetylindole

CAS: 4264-35-1

Formula: C₁₀H₉NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 159.1846

Ref: IN-DA00C9BS

2-Acetylindole

CAS: 4264-35-1

Ref: 7W-GK7556

2-Acetylindole

CAS: 4264-35-1

2-Acetylindole

Purity: 99%

Molecular weight: 159.18g/mol

Ref: 54-OR931775

2-Acetylindole

CAS: 4264-35-1

Formula: C₁₀H₉NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 159.188

Ref: 10-F233601

2-Acetylindole

Controlled Product

CAS: 4264-35-1

Applications An indole derivative used in synthesis of matrix metalloprotease inhibitors.
References Somei, M., et al.: Nat. Prod. Rep., 22, 73 (2005),

Formula: C₁₀H₉NO

Color and Shape: Neat

Molecular weight: 159.18

Ref: TR-A179250