CAS 426463-05-0

2-Chloro-5-iodo-3-nitropyridine

Description:

2-Chloro-5-iodo-3-nitropyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a chlorine atom, an iodine atom, and a nitro group. The molecular structure features a six-membered aromatic ring containing five carbon atoms and one nitrogen atom, which contributes to its basicity and reactivity. The chlorine and iodine substituents introduce significant steric and electronic effects, influencing the compound's reactivity and potential applications in organic synthesis and medicinal chemistry. The nitro group is known for its electron-withdrawing properties, which can enhance the compound's electrophilicity. This compound is typically used in research and development, particularly in the synthesis of pharmaceuticals and agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and solvents used. Safety precautions should be taken when handling this compound, as halogenated and nitro-substituted compounds can pose health risks.

Formula: C₅H₂ClIN₂O₂

InChI: InChI=1S/C5H2ClIN2O2/c6-5-4(9(10)11)1-3(7)2-8-5/h1-2H

InChI key: InChIKey=PIJMRJPJERUFNI-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(Cl)N=CC(I)=C1

Synonyms:

• 2-Chloro-5-iodo-3-nitropyridine
• Pyridine, 2-chloro-5-iodo-3-nitro-

2-Chloro-5-iodo-3-nitropyridine

CAS: 426463-05-0

Formula: C₅H₂ClIN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 284.4390

Ref: IN-DA003GZ1

2-Chloro-5-iodo-3-nitropyridine

CAS: 426463-05-0

2-Chloro-5-iodo-3-nitropyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 284.44g/mol

Ref: 54-OR18618

2-Chloro-5-iodo-3-nitropyridine

CAS: 426463-05-0

Formula: C₅H₂ClIN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 284.44

Ref: 10-F231480