CAS 4266-66-4

1,8-diazacyclotetradecane-2,7-dione

Description:

1,8-Diazacyclotetradecane-2,7-dione, with the CAS number 4266-66-4, is a bicyclic compound featuring a diazacyclic structure. This compound contains two nitrogen atoms within a 14-membered ring, contributing to its unique chemical properties. The presence of carbonyl groups at the 2 and 7 positions enhances its reactivity, making it a potential candidate for various chemical reactions, including coordination chemistry and ligand formation. The compound is typically characterized by its solid state at room temperature and may exhibit solubility in polar solvents due to the presence of the carbonyl functionalities. Its structure allows for potential applications in fields such as medicinal chemistry, where it may serve as a scaffold for drug development, or in materials science for the synthesis of novel polymers. Additionally, the nitrogen atoms can participate in hydrogen bonding, influencing the compound's physical properties and interactions with other molecules. Overall, 1,8-diazacyclotetradecane-2,7-dione is a versatile compound with significant implications in various chemical research areas.

Formula: C₁₂H₂₂N₂O₂

InChI: InChI=1/C12H22N2O2/c15-11-7-3-4-8-12(16)14-10-6-2-1-5-9-13-11/h1-10H2,(H,13,15)(H,14,16)

SMILES: C1CCCN=C(CCCCC(=NCC1)O)O

1,8-Diazacyclotetradecane-2,7-dione

CAS: 4266-66-4

Formula: C₁₂H₂₂N₂O₂

Color and Shape: Solid

Molecular weight: 226.3153

Ref: IN-DA0037UP

Nylon 6,6 Monomer

CAS: 4266-66-4

Formula: C₁₂H₂₂N₂O₂

Molecular weight: 226.32

Ref: 4Z-N-165001

1.8-Diazacyclotetradecane-2,7-dione

CAS: 4266-66-4

Formula: C₁₂H₂₂N₂O₂

Color and Shape: White To Off-White

Molecular weight: 226.32

Ref: TR-D494800

1.8-Diazacyclotetradecane-2,7-dione

CAS: 4266-66-4

1.8-Diazacyclotetradecane-2,7-dione is a solid formed as an unwanted side-product in the conventional process to form Nylon 66 from adipic acid and hexamethylene diamine. The 1.8-diazacyclotetradecane-2,7-dione thus produced can be washed out of the final Nylon polymer. However, an alternative process allows for 1.8-diazacyclotetradecane-2,7-dione to be used as part of the feedstock for Nylon 66 and other lower molecular weight polymers.

Formula: C₁₂H₂₂N₂O₂

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 226.32 g/mol

Ref: 3D-FD36374