CymitQuimica logo

CAS 426825-75-4

:

6-iodoimidazo[1,2-a]pyridine

Description:
6-Iodoimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, with an iodine atom substituted at the 6-position of the imidazole ring. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the iodine atom can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, 6-iodoimidazo[1,2-a]pyridine may exhibit properties such as fluorescence, which can be useful in various analytical applications. The compound's unique structural features allow for diverse synthetic modifications, enabling the exploration of its derivatives for enhanced efficacy or selectivity in biological assays. Overall, this compound represents a valuable scaffold in drug discovery and development, particularly in the context of targeting specific biological pathways.
Formula:C7H5IN2
InChI:InChI=1/C7H5IN2/c8-6-1-2-7-9-3-4-10(7)5-6/h1-5H
InChI key:ZYXOOFUOEJPQKM-UHFFFAOYSA-N
SMILES:c1cc2nccn2cc1I
Synonyms:
  • Imidazo[1,2-A]Pyridine, 6-Iodo-
Found 4 products.