CAS 426834-38-0

4-chloro-2-({[3-(trifluoromethyl)phenyl]carbamoyl}amino)benzoic acid

Description:

4-Chloro-2-({[3-(trifluoromethyl)phenyl]carbamoyl}amino)benzoic acid, with the CAS number 426834-38-0, is a chemical compound characterized by its complex structure, which includes a chloro substituent, a trifluoromethyl group, and a carboxylic acid functional group. This compound is typically classified as an aromatic amide due to the presence of the amide linkage between the benzoic acid and the phenyl group. The trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, potentially forming salts or esters. Additionally, the chlorine atom may impart unique electronic properties, affecting the compound's reactivity and interaction with biological targets. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₁₅H₁₀ClF₃N₂O₃

InChI: InChI=1/C15H10ClF3N2O3/c16-9-4-5-11(13(22)23)12(7-9)21-14(24)20-10-3-1-2-8(6-10)15(17,18)19/h1-7H,(H,22,23)(H2,20,21,24)

SMILES: c1cc(cc(c1)N=C(Nc1cc(ccc1C(=O)O)Cl)O)C(F)(F)F

Synonyms:

• Benzoic Acid, 4-Chloro-2-[[[[3-(Trifluoromethyl)Phenyl]Amino]Carbonyl]Amino]-

NS3694

CAS: 426834-38-0

NS3694

Purity: ≥98%

Molecular weight: 358.7g/mol

Ref: 54-BUP08157

NS3694

CAS: 426834-38-0

Formula: C₁₅H₁₀ClF₃N₂O₃

Molecular weight: 358.70

Ref: 7W-GL2340

NS3694

CAS: 426834-38-0

NS3694 is an inhibitor of apoptosis and inhibits apoptosome formation and caspase activation.

Formula: C₁₅H₁₀ClF₃N₂O₃

Purity: 99.83%

Color and Shape: Solid

Molecular weight: 358.7

Ref: TM-T22119