CAS 4270-38-6

3-[(4-Ethoxyphenyl)amino]-3-oxopropanoic acid

Description:

3-[(4-Ethoxyphenyl)amino]-3-oxopropanoic acid, with the CAS number 4270-38-6, is an organic compound characterized by its structure, which includes an amino group, a ketone, and a carboxylic acid functional group. This compound features a 4-ethoxyphenyl group attached to the amino nitrogen, contributing to its aromatic properties and potentially influencing its solubility and reactivity. The presence of the oxopropanoic acid moiety suggests that it may exhibit acidic behavior, making it relevant in various chemical reactions, including those involving nucleophiles or electrophiles. Its molecular structure allows for potential interactions in biological systems, which may lead to applications in pharmaceuticals or agrochemicals. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, 3-[(4-Ethoxyphenyl)amino]-3-oxopropanoic acid is a compound of interest in organic chemistry and medicinal chemistry due to its unique structural features.

Formula: C₁₁H₁₃NO₄

InChI: InChI=1/C11H13NO4/c1-2-16-9-5-3-8(4-6-9)12-10(13)7-11(14)15/h3-6H,2,7H2,1H3,(H,12,13)(H,14,15)

InChI key: InChIKey=CLYZAEDHBXTZBW-UHFFFAOYSA-N

SMILES: N(C(CC(O)=O)=O)C1=CC=C(OCC)C=C1

Synonyms:

• 2-[(4-Ethoxyphenyl)carbamoyl]acetic acid
• Malonanilic acid, 4′-ethoxy-
• Propanoic Acid, 3-[(4-Ethoxyphenyl)Amino]-3-Oxo-
• 3-[(4-Ethoxyphenyl)amino]-3-oxopropanoic acid

3-[(4-ethoxyphenyl)amino]-3-oxopropanoic acid

CAS: 4270-38-6

Formula: C₁₁H₁₃NO₄

Purity: 95.0%

Molecular weight: 223.228

Ref: 10-F310167