CAS 42711-75-1
:3-hydroxyadamantane-1-carboxylic acid
Description:
3-Hydroxyadamantane-1-carboxylic acid, with the CAS number 42711-75-1, is a chemical compound characterized by its unique adamantane structure, which is a polycyclic hydrocarbon known for its stability and rigidity. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to the adamantane framework, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of the hydroxyl group enhances its solubility in polar solvents, while the carboxylic acid group can participate in various chemical reactions, such as esterification and amidation. Additionally, the compound may exhibit interesting biological properties, making it a subject of research in pharmacology. Its structural characteristics, including the three-dimensional arrangement of atoms, can influence its reactivity and interactions with biological systems. Overall, 3-hydroxyadamantane-1-carboxylic acid represents a significant compound in the study of organic and medicinal chemistry due to its unique properties and potential applications.
Formula:C11H16O3
InChI:InChI=1/C11H16O3/c12-9(13)10-2-7-1-8(3-10)5-11(14,4-7)6-10/h7-8,14H,1-6H2,(H,12,13)
SMILES:C1C2CC3(CC1CC(C2)(C3)O)C(=O)O
Synonyms:- 3-Hydroxy--1-Amantane Carboxylic Acid
- 3-Hydroxy-1-adamantanecarboxylic acid
- 3-Hydroxy-1-Adamantane Carboxylic Acid
- (5R,7R)-3-hydroxytricyclo[3.3.1.1~3,7~]decane-1-carboxylate
- 3-Hydroxytricyclo[3.3.1.1~3,7~]Decane-1-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Hydroxy-1-adamantanecarboxylic Acid
CAS:Formula:C11H16O3Purity:>97.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:196.253-Hydroxyadamantane-1-carboxylic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H15O3Purity:97%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:195.243-hydroxyadamantane-1-carboxylic acid
CAS:Formula:C11H16O3Purity:95%Color and Shape:SolidMolecular weight:196.24293-Hydroxyadamantane-1-carboxylic acid
CAS:3-Hydroxyadamantane-1-carboxylic acidFormula:C11H16O3Purity:98%Color and Shape: white powderMolecular weight:196.24g/mol3-Hydroxy-1-adamantanecarboxylic acid
CAS:8-Hydroxyadamantane-1-carboxylic acid (8HA) is a drug that is used in the treatment of HIV. It is a prodrug that is converted to active form by the liver and then excreted by the kidneys. 8HA has antiviral activity against HIV and other viruses. The optimal reaction conditions for this compound are pH 7, chloride concentration 1M, copper concentration 0.5M, and temperature 50°C. 8HA binds to the viral envelope glycoprotein gp120 as well as to host cells in order to inhibit viral replication and replication. This compound also inhibits the production of antibodies, which may be due to its ability to bind with antibody molecules through an ionic bond at a neutral pH.Formula:C11H16O3Purity:Min. 95%Color and Shape:PowderMolecular weight:196.24 g/mol3-Hydroxy-adamantane-1-carboxylic acid
CAS:Formula:C11H16O3Purity:95%Color and Shape:Solid, solidMolecular weight:196.246






