CymitQuimica logo

CAS 42711-75-1

:

3-hydroxyadamantane-1-carboxylic acid

Description:
3-Hydroxyadamantane-1-carboxylic acid, with the CAS number 42711-75-1, is a chemical compound characterized by its unique adamantane structure, which is a polycyclic hydrocarbon known for its stability and rigidity. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to the adamantane framework, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of the hydroxyl group enhances its solubility in polar solvents, while the carboxylic acid group can participate in various chemical reactions, such as esterification and amidation. Additionally, the compound may exhibit interesting biological properties, making it a subject of research in pharmacology. Its structural characteristics, including the three-dimensional arrangement of atoms, can influence its reactivity and interactions with biological systems. Overall, 3-hydroxyadamantane-1-carboxylic acid represents a significant compound in the study of organic and medicinal chemistry due to its unique properties and potential applications.
Formula:C11H16O3
InChI:InChI=1/C11H16O3/c12-9(13)10-2-7-1-8(3-10)5-11(14,4-7)6-10/h7-8,14H,1-6H2,(H,12,13)
InChI key:CJJMAWPEZKYJAP-UHFFFAOYSA-N
SMILES:C1C2CC3(CC1CC(C2)(C3)O)C(=O)O
Synonyms:
  • 3-Hydroxy--1-Amantane Carboxylic Acid
  • 3-Hydroxy-1-adamantanecarboxylic acid
  • 3-Hydroxy-1-Adamantane Carboxylic Acid
  • (5R,7R)-3-hydroxytricyclo[3.3.1.1~3,7~]decane-1-carboxylate
  • 3-Hydroxytricyclo[3.3.1.1~3,7~]Decane-1-Carboxylic Acid
Found 7 products.