CAS 42746-49-6
:5-benzyl-1,3-oxazolidin-2-one
Description:
5-benzyl-1,3-oxazolidin-2-one is a heterocyclic organic compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The presence of the benzyl group contributes to its hydrophobic characteristics, influencing its solubility and reactivity. As an oxazolidinone, it may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of antibiotics and other pharmaceuticals. The compound's structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, its stability under standard conditions and the ability to undergo various chemical transformations make it a valuable intermediate in organic synthesis. Overall, 5-benzyl-1,3-oxazolidin-2-one is a versatile compound with significant implications in both research and industry.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c12-10-11-7-9(13-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,12)
SMILES:c1ccc(cc1)CC1CN=C(O)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-benzyl-1,3-oxazolidin-2-one
CAS:Controlled Product<p>Applications 5-benzyl-1,3-oxazolidin-2-one (cas# 42746-49-6) is a useful research chemical.<br></p>Formula:C10H11NO2Color and Shape:NeatMolecular weight:177.25-Benzyl-1,3-oxazolidin-2-one
CAS:<p>5-Benzyl-1,3-oxazolidin-2-one is a nonsteroidal antiinflammatory drug that acts as an analgesic and antipyretic. It inhibits the enzyme cyclooxygenase to reduce prostaglandin synthesis. 5-Benzyl-1,3-oxazolidin-2-one is a prodrug that is metabolized to its active form by hydrolysis of the ester linkage. The hydrolysis of this bond requires the presence of acid such as carbonic acid or trifluoromethyl acid. This drug also has antiinflammatory properties and has been shown to be effective in the treatment of muscle pain.<br>5-Benzyl-1,3-oxazolidin-2-one binds to phenoxy and aralkyl groups in proteins, which may account for its analgesic effects.</p>Formula:C10H11NO2Purity:Min. 95%Molecular weight:177.2 g/mol

