
CAS 42749-29-1
:2H-Pyran, 2,2′-[3,6,9,12,15,18,21,24,27-nonaoxanonacosane-1,29-diylbis(oxy)]bis[tetrahydro-
Description:
2H-Pyran, 2,2′-[3,6,9,12,15,18,21,24,27-nonaoxanonacosane-1,29-diylbis(oxy)]bis[tetrahydro-], identified by CAS number 42749-29-1, is a complex organic compound characterized by its unique structural features. It contains a pyran ring, which is a six-membered heterocyclic compound with one oxygen atom, contributing to its reactivity and potential applications in organic synthesis. The presence of a long-chain nonacosane moiety, consisting of multiple ether linkages, suggests that this compound may exhibit interesting solubility properties and could be utilized in various fields, including materials science and pharmaceuticals. The tetrahydro component indicates that the compound may possess saturated characteristics, which can influence its stability and reactivity. Overall, the combination of these structural elements suggests that this compound may have potential applications in specialized chemical processes or as a building block in the synthesis of more complex molecules. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C30H58O13
InChI:InChI=1S/C30H58O13/c1-3-7-40-29(5-1)42-27-25-38-23-21-36-19-17-34-15-13-32-11-9-31-10-12-33-14-16-35-18-20-37-22-24-39-26-28-43-30-6-2-4-8-41-30/h29-30H,1-28H2
InChI key:InChIKey=ZLPQTQVPFMTVDO-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC1CCCCO1)C2CCCCO2
Synonyms:- 2H-Pyran, 2,2′-[3,6,9,12,15,18,21,24,27-nonaoxanonacosane-1,29-diylbis(oxy)]bis[tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
THP-PEG10-THP
CAS:<p>THP-PEG10-THP is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.</p>Formula:C30H58O13Color and Shape:SolidMolecular weight:626.781
