CAS 42754-82-5

3-Phenyl-1H-pyrazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione

Description:

3-Phenyl-1H-pyrazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione, with the CAS number 42754-82-5, is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings. This compound typically exhibits a solid-state form and is known for its potential biological activities, including anti-inflammatory and anticancer properties. The presence of the phenyl group contributes to its aromatic character, which can influence its reactivity and solubility. The dione functional groups indicate that it contains two carbonyl (C=O) functionalities, which can participate in various chemical reactions, such as nucleophilic attacks. The compound's structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its identity and purity. Overall, 3-Phenyl-1H-pyrazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione represents a significant class of compounds in pharmaceutical research.

Formula: C₁₁H₈N₄O₂

InChI: InChI=1S/C11H8N4O2/c16-10-7-8(6-4-2-1-3-5-6)14-15-9(7)12-11(17)13-10/h1-5H,(H3,12,13,14,15,16,17)

SMILES: c1ccc(cc1)c1c2c(nc(=O)nc2O)[nH][nH]1

Synonyms:

• 1H-Pyrazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione, 3-phenyl-

3-Phenyl-1H-pyrazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione

CAS: 42754-82-5

Formula: C₁₁H₈N₄O₂

Molecular weight: 228.2068

Ref: IN-DA00D786

3-Phenyl-1H-pyrazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione

CAS: 42754-82-5

3-Phenyl-1H-pyrazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione

Purity: ≥95%

Molecular weight: 228.21g/mol

Ref: 54-OR305359