CAS 4277-45-6

3-(Acetylamino)-3,6-dideoxy-D-galactose

Description:

3-(Acetylamino)-3,6-dideoxy-D-galactose, with the CAS number 4277-45-6, is a carbohydrate derivative characterized by its unique structural features. It is a dideoxy sugar, meaning it lacks hydroxyl groups at specific positions, which influences its reactivity and biological properties. The presence of an acetylamino group at the 3-position enhances its solubility and can affect its interaction with biological molecules, making it of interest in medicinal chemistry and glycoscience. This compound typically appears as a white to off-white solid and is soluble in polar solvents. Its molecular structure allows for potential applications in the synthesis of glycosylated compounds and as a building block in the development of glycoproteins or glycolipids. Additionally, its modifications can lead to variations in biological activity, making it a subject of research in areas such as drug design and carbohydrate chemistry. Overall, 3-(Acetylamino)-3,6-dideoxy-D-galactose serves as a valuable compound in both synthetic and biological contexts.

Formula: C₈H₁₅NO₅

InChI: InChI=1S/C8H15NO5/c1-4(11)8(14)7(6(13)3-10)9-5(2)12/h3-4,6-8,11,13-14H,1-2H3,(H,9,12)/t4-,6+,7-,8+/m1/s1

InChI key: InChIKey=NGULQTOJUIQGLA-APTPUMFKSA-N

SMILES: [C@H]([C@H]([C@@H](C)O)O)([C@H](C=O)O)NC(C)=O

Synonyms:

• 3-Acetamido-3,6-dideoxy-D-galactose
• 3-(Acetylamino)-3,6-dideoxy-D-galactose
• Galactose, 3-acetamido-3,6-dideoxy-, D-
• D-Galactose, 3-(acetylamino)-3,6-dideoxy-

3-Acetamido-3,6-dideoxy-D-galactose

CAS: 4277-45-6

Ref: 7W-GC6383

3-Acetamido-3,6-dideoxy-D-galactose

CAS: 4277-45-6

3-Acetamido-3,6-dideoxy-D-galactose

Purity: 95%

Molecular weight: 205.2084g/mol

Ref: 54-BICL5012

3-Acetamido-3,6-dideoxy-D-galactose

CAS: 4277-45-6

3-Acetamido-3,6-dideoxy-D-galactose is a monosaccharide with two functional groups. It has been shown to be bifunctional and can act as a glycosyl donor or acceptor. 3-Acetamido-3,6-dideoxy-D-galactose was isolated from the type strain of Streptomyces venezuelae. It is also found in fatty acids and some strains of bacteria, such as Bacillus megaterium. The biological properties of 3-acetamido--3,6-dideoxy--D--galactose have been studied using monoclonal antibodies, magnetic resonance spectroscopy (MRS), and 13C nuclear magnetic resonance spectroscopy (NMR).

Formula: C₈H₁₅NO₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 205.21 g/mol

Ref: 3D-MA46732