CAS 42772-85-0
:2-hydroxyethyl 4-methylbenzenesulfonate
Description:
2-Hydroxyethyl 4-methylbenzenesulfonate, with the CAS number 42772-85-0, is an organic compound characterized by the presence of a sulfonate group attached to a benzene ring, which is further substituted with a methyl group and a hydroxyethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in water and various organic solvents, making it versatile for different applications. The sulfonate group imparts significant polarity, enhancing its reactivity and potential as a surfactant or emulsifying agent. Additionally, the hydroxyethyl group contributes to its hydrophilicity, while the methyl group can influence its steric properties and overall stability. This compound may be utilized in various industrial applications, including as an intermediate in the synthesis of other chemicals, in pharmaceuticals, or as a reagent in organic chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H12O4S
InChI:InChI=1/C9H12O4S/c1-8-2-4-9(5-3-8)14(11,12)13-7-6-10/h2-5,10H,6-7H2,1H3
SMILES:Cc1ccc(cc1)S(=O)(=O)OCCO
Synonyms:- 2-[(4-Methylbenzenesulfonyl)oxy]ethan-1-ol
- 2-Hydroxyethyl-4-methyl benzene sulphonate
- 2-(4-Methylphenyl)sulfonyloxyethanol
- Theophylline Impurity 9
- 42772-85-0
- OH-PEG1-Tos
- 2-HYDROXYETHYL 4-METHYLBENZENESULFONATE
- 1,2-Ethanediol, 1-(4-methylbenzenesulfonate)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Hydroxyethyl 4-Methylbenzenesulfonate
CAS:2-Hydroxyethyl 4-MethylbenzenesulfonatePurity:98%Molecular weight:216.25g/mol2-[(4-Methylbenzenesulfonyl)oxy]ethan-1-ol
CAS:<p>2-[(4-Methylbenzenesulfonyl)oxy]ethan-1-ol is a compound that contains a benzene ring and an ethyl chain. It has the following chemical structure: It is structurally related to benzodiazepine, but with an amide group instead of a diazepine ring. 2-[(4-Methylbenzenesulfonyl)oxy]ethan-1-ol is a membrane stabilizer that inhibits thrombin and can be used as an anticoagulant. This compound also has growth factor activity and can be used in the synthesis of heterocyclic compounds.</p>Formula:C9H12O4SPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:216.26 g/mol




