CAS 42779-56-6
:2,4-Dichloro-6-methylpyridine
Description:
2,4-Dichloro-6-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two chlorine atoms and a methyl group. The molecular formula of this compound is C7H6Cl2N, indicating the presence of seven carbon atoms, six hydrogen atoms, two chlorine atoms, and one nitrogen atom. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. This compound is known for its role as an intermediate in the synthesis of various agrochemicals and pharmaceuticals. It exhibits moderate to low solubility in water but is more soluble in organic solvents, making it useful in various chemical reactions. The presence of chlorine atoms contributes to its reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, 2,4-Dichloro-6-methylpyridine may have specific applications in the field of material science and as a building block in organic synthesis. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.
Formula:C6H5Cl2N
InChI:InChI=1/C6H5Cl2N/c1-4-2-5(7)3-6(8)9-4/h2-3H,1H3
SMILES:Cc1cc(cc(Cl)n1)Cl
Synonyms:- Pyridine, 2,4-dichloro-6-methyl-
- 2,4-Dichloro-6-picoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Dichloro-6-methylpyridine, 97+%
CAS:<p>It is an important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. </p>Formula:C6H5Cl2NPurity:97+%Molecular weight:162.012,4-Dichloro-6-methylpyridine
CAS:Formula:C6H5Cl2NPurity:97%Color and Shape:LiquidMolecular weight:162.01662,4-Dichloro-6-methylpyridine
CAS:2,4-Dichloro-6-methylpyridineFormula:C6H5Cl2NPurity:97%Color and Shape: liquidMolecular weight:162.02g/mol2,4-Dichloro-6-methylpyridine
CAS:Formula:C6H5Cl2NPurity:97%Color and Shape:LiquidMolecular weight:162.01



