CAS 427886-21-3
:B-(4-Chloro-3,5-dimethoxyphenyl)boronic acid
Description:
B-(4-Chloro-3,5-dimethoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted phenyl ring. The compound features a boron atom bonded to a phenyl group that has chlorine and methoxy substituents, which influence its reactivity and solubility. The chlorine atom, being an electron-withdrawing group, enhances the electrophilic character of the boron, making it useful in various chemical reactions, particularly in Suzuki coupling reactions for the formation of carbon-carbon bonds. The methoxy groups provide additional steric and electronic effects, which can affect the compound's reactivity and interaction with other molecules. B-(4-Chloro-3,5-dimethoxyphenyl)boronic acid is typically used in organic synthesis, medicinal chemistry, and materials science due to its ability to form stable complexes with various substrates. Its properties, such as solubility in organic solvents and stability under certain conditions, make it a valuable reagent in synthetic chemistry.
Formula:C8H10BClO4
InChI:InChI=1S/C8H10BClO4/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,11-12H,1-2H3
InChI key:InChIKey=YAWMKFIUWSYMGN-UHFFFAOYSA-N
SMILES:O(C)C1=C(Cl)C(OC)=CC(B(O)O)=C1
Synonyms:- 4-Chloro-3,5-dimethoxyphenylboronic acid
- B-(4-Chloro-3,5-dimethoxyphenyl)boronic acid
- Boronic acid, B-(4-chloro-3,5-dimethoxyphenyl)-
- Boronic acid, (4-chloro-3,5-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
