CAS 42792-96-1
:2-methyl-5-nitroisoquinolin-1(2H)-one
Description:
2-Methyl-5-nitroisoquinolin-1(2H)-one is a heterocyclic organic compound characterized by its isoquinoline structure, which features a fused benzene and pyridine ring system. The presence of a methyl group at the second position and a nitro group at the fifth position contributes to its unique chemical properties. This compound typically exhibits a yellow to orange color in solid form and is soluble in organic solvents, such as dimethyl sulfoxide (DMSO) and ethanol, but may have limited solubility in water. It is often used in research and development, particularly in the fields of medicinal chemistry and organic synthesis, due to its potential biological activities. The nitro group can participate in various chemical reactions, making it a versatile intermediate in synthetic pathways. Additionally, the compound's structure may influence its reactivity, stability, and interaction with biological targets, which are important considerations in pharmacological studies. Safety data should be reviewed before handling, as nitro compounds can pose health risks.
Formula:C10H8N2O3
InChI:InChI=1/C10H8N2O3/c1-11-6-5-7-8(10(11)13)3-2-4-9(7)12(14)15/h2-6H,1H3
SMILES:Cn1ccc2c(cccc2N(=O)=O)c1=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Methyl-5-nitro-1,2-dihydroisoquinolin-1-one
CAS:2-Methyl-5-nitro-1,2-dihydroisoquinolin-1-one
Molecular weight:204.18g/mol
