CAS 4282-24-0

furan-2,3-dicarboxylic acid

Description:

Furan-2,3-dicarboxylic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing four carbon atoms and one oxygen atom. This compound features two carboxylic acid groups (-COOH) located at the 2 and 3 positions of the furan ring, making it a dicarboxylic acid. It is typically a white to light yellow crystalline solid that is soluble in water and various organic solvents. Furan-2,3-dicarboxylic acid is known for its potential applications in the synthesis of polymers, particularly in the production of bio-based materials and as a precursor for various chemical intermediates. Its unique structure allows for the formation of esters and amides, which can be utilized in the development of biodegradable plastics. Additionally, this compound exhibits interesting chemical reactivity, including the ability to undergo various substitution reactions due to the presence of the carboxylic acid functional groups. Overall, furan-2,3-dicarboxylic acid is a versatile compound with significant implications in materials science and organic synthesis.

Formula: C₆H₄O₅

InChI: InChI=1/C6H4O5/c7-5(8)3-1-2-11-4(3)6(9)10/h1-2H,(H,7,8)(H,9,10)

SMILES: c1coc(c1C(=O)O)C(=O)O

Synonyms:

• 2,3-Furandicarboxylic acid

Furan-2,3-dicarboxylic acid

CAS: 4282-24-0

Formula: C₆H₄O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 156.0930

Ref: IN-DA00BZP9

Furan-2,3-dicarboxylic acid

CAS: 4282-24-0

Furan-2,3-dicarboxylic acid

Purity: 95%

Molecular weight: 156.09g/mol

Ref: 54-OR1051547

Furan-2,3-dicarboxylic acid

CAS: 4282-24-0

Formula: C₆H₄O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 156.093

Ref: 10-F040192

Furan-2,3-dicarboxylic acid

CAS: 4282-24-0

Furan-2,3-dicarboxylic acid is a fluorogenic probe that reacts with water vapor to form a fluorescent product. The reaction of furan-2,3-dicarboxylic acid with methanol and ethylene glycol yields 2,5-furandicarboxylic acid. This compound is also the product of the reaction of furan-2,3-dicarboxylic acid with magnesium salt in anhydrous sodium carbonate. Furan-2,3-dicarboxylic acid can be oxidized by pyridinium chlorochromate (PCC) to form 5-hydroxymethylfurfural. Furan-2,3-dicarboxylic acid has been shown to react with p-hydroxybenzoic acid in the presence of an oxidation catalyst to yield a furandicarboxyl derivative.

Formula: C₆H₄O₅

Purity: Min. 95%

Molecular weight: 156.09 g/mol

Ref: 3D-EAA28224