CAS 4282-28-4
:furan-2,4-dicarboxylic acid
Description:
Furan-2,4-dicarboxylic acid, with the CAS number 4282-28-4, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features two carboxylic acid groups (-COOH) located at the 2 and 4 positions of the furan ring, contributing to its acidic properties. Furan-2,4-dicarboxylic acid is typically a white to off-white crystalline solid that is soluble in water and various organic solvents, making it versatile for chemical reactions and applications. It is known for its potential use in the synthesis of polymers, particularly in the production of bio-based materials, due to its renewable nature derived from biomass. Additionally, this compound exhibits interesting chemical reactivity, allowing it to participate in various organic transformations, including esterification and amidation. Its unique structure and properties make it a subject of interest in both academic research and industrial applications, particularly in the development of sustainable materials and chemicals.
Formula:C6H4O5
InChI:InChI=1/C6H4O5/c7-5(8)3-1-4(6(9)10)11-2-3/h1-2H,(H,7,8)(H,9,10)
SMILES:c1c(coc1C(=O)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4-FURANDICARBOXYLIC ACID
CAS:Formula:C6H4O5Purity:95%Color and Shape:SolidMolecular weight:156.09302,4-Furandicarboxylic Acid
CAS:Controlled ProductFormula:C6H4O5Color and Shape:NeatMolecular weight:156.0932,4-Furandicarboxylic acid
CAS:<p>2,4-Furandicarboxylic acid is a type of organic compound with the chemical formula C6H2O4. It is an acid that has optical properties and can be used as a reagent in organic synthesis. 2,4-Furandicarboxylic acid is biosynthesized by lactam dehydration, catalyzed by the enzyme 5-hmf. Furan rings are known to form when this compound undergoes oxidation reactions. The presence of furan rings can be detected through magnetic resonance spectroscopy and can be used to determine the concentration of 2,4-furandicarboxylic acid in urine samples.</p>Formula:C6H4O5Purity:Min. 95%Molecular weight:156.09 g/mol





