CAS 4282-33-1

dimethyl furan-3,4-dicarboxylate

Description:

Dimethyl furan-3,4-dicarboxylate is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features two carboxylate ester groups (-COOCH3) attached to the furan ring at the 3 and 4 positions, making it a diester. It is typically a colorless to pale yellow liquid with a pleasant odor. Dimethyl furan-3,4-dicarboxylate is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic furan ring. The compound is of interest in various chemical applications, including as a building block in organic synthesis and potential use in the production of biodegradable polymers. Its reactivity is influenced by the presence of the ester groups, which can undergo hydrolysis, transesterification, and other nucleophilic substitution reactions. Additionally, it may exhibit moderate toxicity, necessitating appropriate safety measures during handling and use.

Formula: C₈H₈O₅

InChI: InChI=1/C8H8O5/c1-11-7(9)5-3-13-4-6(5)8(10)12-2/h3-4H,1-2H3

SMILES: COC(=O)c1cocc1C(=O)OC

Synonyms:

• 3,4-Bis(Methoxycarbonyl)furan
• 3,4-Furandicarboxylic Acid, Dimethyl Ester
• Dimethyl furan-3,4-dicarboxylate

DIMETHYL 3,4-FURANDICARBOXYLATE

CAS: 4282-33-1

Formula: C₈H₈O₅

Purity: %

Color and Shape: Solid

Molecular weight: 184.1461

Ref: IN-DA00BXJQ

Dimethyl 3,4-Furandicarboxylate

CAS: 4282-33-1

Dimethyl 3,4-Furandicarboxylate

Purity: 98%

Molecular weight: 184.15g/mol

Ref: 54-OR1012924

Dimethyl furan-3,4-dicarboxylate

CAS: 4282-33-1

Purity: 95+%

Molecular weight: 184.1470032

Ref: 10-F608243