CymitQuimica logo

CAS 42823-24-5

:

4-(trifluoromethoxy)aniline hydrochloride

Description:
4-(Trifluoromethoxy)aniline hydrochloride is a chemical compound characterized by its aniline structure substituted with a trifluoromethoxy group. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and alcohols, which is common for hydrochloride salts. The presence of the trifluoromethoxy group imparts unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The trifluoromethoxy moiety can enhance lipophilicity and influence the compound's biological activity. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. Safety data indicates that, like many aniline derivatives, it should be handled with care due to potential toxicity and irritant properties. Proper safety measures, including the use of personal protective equipment, are recommended when working with this compound. Overall, 4-(trifluoromethoxy)aniline hydrochloride is a valuable compound in synthetic chemistry and material science.
Formula:C7H7ClF3NO
InChI:InChI=1/C7H6F3NO.ClH/c8-7(9,10)12-6-3-1-5(11)2-4-6;/h1-4H,11H2;1H
InChI key:JKQIMISQMPPBGR-UHFFFAOYSA-N
SMILES:c1cc(ccc1N)OC(F)(F)F.Cl
Found 4 products.