CymitQuimica logo

CAS 42834-01-5

:

2-bromo-5-ethoxypyridine

Description:
2-Bromo-5-ethoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and an ethoxy group at the 5-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to the hydrophobic nature of the ethoxy group. 2-Bromo-5-ethoxypyridine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its reactivity is influenced by the electron-withdrawing effect of the bromine atom and the electron-donating effect of the ethoxy group, which can affect the compound's stability and reactivity in different chemical environments.
Formula:C7H8BrNO
InChI:InChI=1/C7H8BrNO/c1-2-10-6-3-4-7(8)9-5-6/h3-5H,2H2,1H3
InChI key:RXVSMILQHDQEDM-UHFFFAOYSA-N
SMILES:CCOc1ccc(Br)nc1
Synonyms:
  • Pyridine, 2-Bromo-5-Ethoxy-
Found 5 products.