CAS 42839-65-6

2,4-Imidazolidinedione, 1-amino-5-hydroxy-

Description:

2,4-Imidazolidinedione, 1-amino-5-hydroxy- is a chemical compound characterized by its imidazolidine ring structure, which features two carbonyl groups and an amino group. This compound is often recognized for its potential biological activity, particularly in the context of pharmaceuticals and biochemistry. It is a white to off-white solid that is soluble in water and polar organic solvents, making it versatile for various applications. The presence of both amino and hydroxy functional groups contributes to its reactivity and ability to form hydrogen bonds, which can influence its interactions in biological systems. Additionally, this compound may exhibit properties such as antioxidant activity or serve as a precursor in synthetic pathways for more complex molecules. Its CAS number, 42839-65-6, allows for precise identification in chemical databases and literature. Overall, 2,4-Imidazolidinedione, 1-amino-5-hydroxy- is of interest in medicinal chemistry and research due to its unique structural features and potential therapeutic applications.

Formula: C₃H₅N₃O₃

InChI: InChI=1S/C3H5N3O3/c4-6-2(8)1(7)5-3(6)9/h2,8H,4H2,(H,5,7,9)

InChI key: InChIKey=ZUFWQWBMQFTALT-UHFFFAOYSA-N

SMILES: OC1N(N)C(=O)NC1=O

Synonyms:

• 2,4-Imidazolidinedione, 1-amino-5-hydroxy-
• 1-Amino-5-hydroxyhydantonin
• 1-Amino-5-hydroxyimidazolidine-2,4-dione

1-Amino-5-hydroxyhydantonin

CAS: 42839-65-6

Formula: C₃H₅N₃O₃

Molecular weight: 131.09

Ref: ST-EA-CP-D103011