CAS 4284-50-8
:N-(4-Bromophenyl)methanesulfonamide
Description:
N-(4-Bromophenyl)methanesulfonamide, with the CAS number 4284-50-8, is an organic compound characterized by the presence of a sulfonamide functional group attached to a methanesulfonyl moiety and a para-bromophenyl group. This compound typically appears as a solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the sulfonamide group, which can engage in hydrogen bonding. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. N-(4-Bromophenyl)methanesulfonamide may exhibit properties such as antibacterial or antitumor activity, depending on its specific interactions with biological targets. Its synthesis generally involves the reaction of 4-bromoaniline with methanesulfonyl chloride. As with many sulfonamides, it may also be subject to regulatory scrutiny due to potential environmental and health impacts. Proper handling and storage conditions are essential to maintain its stability and efficacy in research or pharmaceutical applications.
Formula:C7H8BrNO2S
InChI:InChI=1S/C7H8BrNO2S/c1-12(10,11)9-7-4-2-6(8)3-5-7/h2-5,9H,1H3
InChI key:InChIKey=KKOIRAFXKFYZHQ-UHFFFAOYSA-N
SMILES:N(S(C)(=O)=O)C1=CC=C(Br)C=C1
Synonyms:- 4′-Bromomethanesulfonanilide
- Methanesulfonanilide, 4′-bromo-
- methanesulfonamide, N-(4-bromophenyl)-
- N-(4-Bromophenyl)methanesulfonamide
- N-(4-Bromophenyl)methanesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(4-Bromophenyl)methanesulfonamide
CAS:Formula:C7H8BrNO2SPurity:98%Color and Shape:SolidMolecular weight:250.1129N-(4-Bromophenyl)methanesulfonamide
CAS:N-(4-Bromophenyl)methanesulfonamidePurity:98%Molecular weight:250.11g/molN-(4-Bromophenyl)-methanesulfonamide
CAS:Formula:C7H8BrNO2SPurity:98%Color and Shape:SolidMolecular weight:250.11N-(4-Bromophenyl)methanesulfonamide
CAS:<p>N-(4-Bromophenyl)methanesulfonamide, also known as bromfenac, is a nonsteroidal anti-inflammatory drug (NSAID) of the sulfonanilide class. It binds to the COX enzyme and inhibits prostaglandin synthesis. The COX enzyme catalyzes the conversion of arachidonic acid to prostaglandins. This inhibition leads to reduction in inflammation and pain. Bromfenac has been shown to inhibit the production of pro-inflammatory cytokines such as TNF-α and IL-1β in vitro. Bromfenac is a crystalline compound with a molecular weight of 285.2 Da and consists of one chain with two hydrogen bonds that are both ionic and covalent in nature.</p>Formula:BrC6H4NHSO2CH3Purity:Min. 95%Molecular weight:250.11 g/mol



