CAS 428497-01-2
:1-(3-fluorophenyl)-2,5-dimethyl-1H-pyrrole-3-carbaldehyde
Description:
1-(3-Fluorophenyl)-2,5-dimethyl-1H-pyrrole-3-carbaldehyde is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a 3-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the meta position, contributing to the compound's unique electronic and steric properties. The two methyl groups at the 2 and 5 positions of the pyrrole enhance its hydrophobic character and influence its reactivity. The aldehyde functional group at the 3-position of the pyrrole makes it a versatile intermediate in organic synthesis, allowing for further functionalization. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its physical properties, such as solubility and melting point, would depend on the specific conditions and solvent used. Overall, this compound represents a valuable scaffold for the development of new chemical entities in various applications.
Formula:C13H12FNO
InChI:InChI=1/C13H12FNO/c1-9-6-11(8-16)10(2)15(9)13-5-3-4-12(14)7-13/h3-8H,1-2H3
SMILES:Cc1cc(C=O)c(C)n1c1cccc(c1)F
Synonyms:- 1H-pyrrole-3-carboxaldehyde, 1-(3-fluorophenyl)-2,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(3-Fluorophenyl)-2,5-dimethyl-1H-pyrrole-3-carbaldehyde
CAS:Formula:C13H12FNOMolecular weight:217.2389
