CAS 4285-42-1
:N-Methyl-N-phenylcarbamic chloride
Description:
N-Methyl-N-phenylcarbamic chloride, with the CAS number 4285-42-1, is an organic compound that belongs to the class of carbamates. It is characterized by the presence of a carbamic acid derivative, where a methyl group and a phenyl group are attached to the nitrogen atom. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor. It is known for its reactivity, particularly as a chlorinating agent, and can participate in various chemical reactions, including nucleophilic substitutions. N-Methyl-N-phenylcarbamic chloride is soluble in organic solvents, making it useful in synthetic organic chemistry. However, it is important to handle this compound with care due to its potential toxicity and irritant properties. Safety precautions should be taken to avoid exposure, and it should be stored in a cool, well-ventilated area away from incompatible substances. Overall, its unique structure and reactivity make it a valuable intermediate in the synthesis of various chemical products.
Formula:C8H8ClNO
InChI:InChI=1S/C8H8ClNO/c1-10(8(9)11)7-5-3-2-4-6-7/h2-6H,1H3
InChI key:InChIKey=CPGWSLFYXMRNDV-UHFFFAOYSA-N
SMILES:N(C(Cl)=O)(C)C1=CC=CC=C1
Synonyms:- (Methyl)phenylcarbamic chloride
- Carbamic chloride, N-methyl-N-phenyl-
- Carbamic chloride, methylphenyl-
- Carbamoyl chloride, methylphenyl-
- Carbaniloyl chloride, N-methyl-
- Methyl(Phenyl)Carbamic Chloride
- N-Methyl-N-phenylcarbamic acid chloride
- N-Methyl-N-phenylcarbamic chloride
- N-Methyl-N-phenylcarbamoyl chloride
- N-methyl-N-phenylcarbamyl chloride
- Nsc 165671
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Methyl-N-phenylcarbamoyl chloride
CAS:Formula:C8H8ClNOPurity:97%Color and Shape:SolidMolecular weight:169.6082N-Methyl-N-phenylcarbamoyl chloride
CAS:N-Methyl-N-phenylcarbamoyl chloridePurity:98%Molecular weight:169.61g/molN-Methyl-N-phenylcarbamoyl chloride
CAS:N-Methyl-N-phenylcarbamoyl chloride is a fluorinated compound that has been shown to be resistant to treatments with chlorides. It is used for kinetic studies of amines and other functional assays. Deuterium isotope effects have been observed in chloride ion binding experiments, which indicate that the molecule has a greater affinity for the chloride ion than does its non-deuterated counterpart.Formula:C8H8ClNOPurity:Min. 95%Color and Shape:PowderMolecular weight:169.61 g/mol




