CAS 42856-62-2
:2-Methyl-1,5-pentanediol
Description:
2-Methyl-1,5-pentanediol, with the CAS number 42856-62-2, is an organic compound classified as a diol due to the presence of two hydroxyl (-OH) functional groups. It has a branched structure, featuring a methyl group attached to the second carbon of a five-carbon chain. This compound is typically a colorless, viscous liquid at room temperature, exhibiting hygroscopic properties, which means it can absorb moisture from the air. It is soluble in water and various organic solvents, making it versatile for use in different applications. 2-Methyl-1,5-pentanediol is often utilized as a solvent, plasticizer, and in the formulation of coatings and adhesives due to its ability to enhance the properties of these materials. Additionally, it has potential applications in the production of surfactants and as an intermediate in organic synthesis. Safety data indicates that, while it may cause irritation upon contact with skin or eyes, it is generally considered to have low toxicity. Proper handling and safety precautions are recommended when working with this chemical.
Formula:C6H14O2
InChI:InChI=1S/C6H14O2/c1-6(5-8)3-2-4-7/h6-8H,2-5H2,1H3
InChI key:InChIKey=AAAWJUMVTPNRDT-UHFFFAOYSA-N
SMILES:C(CCCO)(CO)C
Synonyms:- 1,5-Pentanediol, 2-methyl-
- 2-Methylpentane-1,5-diol
- 2-Methyl-1,5-pentanediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-Methylpentane-1,5-diol
CAS:Controlled ProductFormula:C6H14O2Color and Shape:NeatMolecular weight:118.174


