CAS 4286-99-1

[4-chloro-2-(chloromethyl)phenoxy]acetic acid

Description:

[4-chloro-2-(chloromethyl)phenoxy]acetic acid, with the CAS number 4286-99-1, is a chemical compound that belongs to the class of phenoxyacetic acids. It features a phenoxy group, which is a phenyl ring bonded to an ether oxygen, and contains both chlorine and carboxylic acid functional groups. This compound is characterized by its chlorinated aromatic structure, which contributes to its potential biological activity. It is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. The presence of chlorine atoms enhances its reactivity and may influence its herbicidal properties, making it of interest in agricultural applications. Additionally, the compound may exhibit specific interactions with biological systems, which could be relevant for its use in various chemical syntheses or as a potential agrochemical. Safety and handling precautions are essential due to the presence of chlorine, which can pose health risks. As with all chemicals, proper storage and disposal methods should be followed to mitigate environmental impact.

Formula: C₉H₈Cl₂O₃

InChI: InChI=1/C9H8Cl2O3/c10-4-6-3-7(11)1-2-8(6)14-5-9(12)13/h1-3H,4-5H2,(H,12,13)

SMILES: c1cc(c(cc1Cl)CCl)OCC(=O)O

Synonyms:

• Acetic Acid, 2-[4-Chloro-2-(Chloromethyl)Phenoxy]-

[4-Chloro-2-(chloromethyl)phenoxy]acetic acid

CAS: 4286-99-1

Formula: C₉H₈Cl₂O₃

Molecular weight: 235.0640

Ref: IN-DA00C5VZ

[4-chloro-2-(chloromethyl)phenoxy]acetic acid

CAS: 4286-99-1

Formula: C₉H₈Cl₂O₃

Purity: 95.0%

Molecular weight: 235.06

Ref: 10-F315359