CAS 4287-29-0

(2R)-2-[(2,5-dimethylphenoxy)methyl]oxirane

Description:

(2R)-2-[(2,5-dimethylphenoxy)methyl]oxirane, also known by its CAS number 4287-29-0, is an organic compound characterized by its epoxide functional group, which is a three-membered cyclic ether. This compound features a chiral center at the carbon atom adjacent to the oxirane ring, contributing to its stereochemistry. The presence of the 2,5-dimethylphenoxy group indicates that it has a phenolic structure with two methyl substituents, which can influence its reactivity and solubility. Generally, compounds like this can exhibit interesting chemical properties, including the ability to undergo ring-opening reactions under various conditions, making them useful intermediates in organic synthesis. Additionally, the steric hindrance introduced by the dimethyl groups may affect the compound's reactivity and interactions with other molecules. Overall, (2R)-2-[(2,5-dimethylphenoxy)methyl]oxirane is significant in the context of synthetic organic chemistry and may have applications in the development of pharmaceuticals or agrochemicals.

Formula: C₁₁H₁₄O₂

InChI: InChI=1/C11H14O2/c1-8-3-4-9(2)11(5-8)13-7-10-6-12-10/h3-5,10H,6-7H2,1-2H3/t10-/m1/s1

SMILES: Cc1ccc(C)c(c1)OC[C@H]1CO1

2-(2,5-Dimethylphenoxymethyl)oxirane

CAS: 4287-29-0

Versatile small molecule scaffold

Formula: C₁₁H₁₄O₂

Purity: Min. 95%

Molecular weight: 178.23 g/mol

Ref: 3D-EAA28729