CAS 42872-29-7
:3-(1-Cyanoethyl)benzoyl chloride
Description:
3-(1-Cyanoethyl)benzoyl chloride, with the CAS number 42872-29-7, is an organic compound characterized by the presence of both a benzoyl chloride and a cyanoethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic substitution reactions. The cyanoethyl group contributes to its potential applications in organic synthesis, particularly in the formation of various derivatives and intermediates. This compound is generally handled with caution due to its corrosive nature and potential to release harmful gases upon hydrolysis. It is soluble in organic solvents, making it useful in various chemical reactions. Safety measures should be observed when working with this substance, including the use of personal protective equipment and proper ventilation, as it can be irritating to the skin, eyes, and respiratory system.
Formula:C10H8ClNO
InChI:InChI=1S/C10H8ClNO/c1-7(6-12)8-3-2-4-9(5-8)10(11)13/h2-5,7H,1H3
InChI key:InChIKey=XXQNFMGCPMJJSJ-UHFFFAOYSA-N
SMILES:C(C#N)(C)C1=CC(C(Cl)=O)=CC=C1
Synonyms:- 3-(1-Cyanoethyl)benzoyl chloride
- m-(1-Cyanoethyl)benzoyl chloride
- 2-[3-(Chloroformyl)phenyl]propionitrile
- Benzoyl chloride, 3-(1-cyanoethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

