CAS 42872-79-7

3-Iodo-4-methylbenzonitrile

Description:

3-Iodo-4-methylbenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both an iodine atom and a methyl group, as well as a cyano group (nitrile). The presence of the iodine atom at the meta position relative to the cyano group and the methyl group at the para position influences its chemical reactivity and physical properties. This compound typically appears as a solid at room temperature and is known for its relatively low solubility in water, while being more soluble in organic solvents. It is often utilized in organic synthesis and medicinal chemistry due to its functional groups, which can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, the presence of the cyano group contributes to its potential as a building block in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of iodine and the toxicity associated with nitriles.

Formula: C₈H₆IN

InChI: InChI=1S/C8H6IN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3

InChI key: InChIKey=YGXPQBKQVKASBM-UHFFFAOYSA-N

SMILES: C(#N)C1=CC(I)=C(C)C=C1

Synonyms:

• 3-Iodo-p-tolunitrile
• Benzonitrile, 3-iodo-4-methyl-
• 3-Iodo-4-methylbenzonitrile

3-Iodo-4-methylbenzonitrile

CAS: 42872-79-7

Formula: C₈H₆IN

Purity: 98%

Color and Shape: Solid

Molecular weight: 243.0444

Ref: IN-DA003JLD

3-Iodo-4-methylbenzonitrile

CAS: 42872-79-7

3-Iodo-4-methylbenzonitrile

Formula: C₈H₆IN

Purity: 95%

Color and Shape: faint to light orange crystalline solid

Molecular weight: 243.04g/mol

Ref: 54-OR40274

3-Iodo-4-methylbenzamidine

CAS: 42872-79-7

3-Iodo-4-methylbenzamidine is a chemical building block that is used as a reagent for the synthesis of other chemicals. 3-Iodo-4-methylbenzamidine is a versatile building block that can be used to synthesize complex compounds. It can also be used to produce fine chemicals and pharmaceuticals, such as antibiotics, chemotherapeutics, and antivirals. 3-Iodo-4-methylbenzamidine has been shown in preliminary research to have anti-inflammatory properties.

Formula: C₈H₆IN

Purity: 90%

Color and Shape: White Powder

Molecular weight: 243.04 g/mol

Ref: 3D-FI55738

3-Iodo-4-methylbenzonitrile

CAS: 42872-79-7

Purity: 98%

Molecular weight: 243.0469971

Ref: 10-F618288