CAS 42877-08-7
:2-Acetyl-3-bromothiophene
Description:
2-Acetyl-3-bromothiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of an acetyl group at the 2-position and a bromine atom at the 3-position contributes to its unique chemical properties. This compound typically appears as a yellow to brown solid and is soluble in organic solvents such as ethanol and dichloromethane. It exhibits reactivity typical of both the thiophene ring and the functional groups attached to it, making it useful in various synthetic applications, including the preparation of more complex organic molecules. The bromine substituent can participate in electrophilic substitution reactions, while the acetyl group can undergo nucleophilic attacks, allowing for further functionalization. Additionally, 2-acetyl-3-bromothiophene may exhibit interesting electronic properties due to the conjugation within the thiophene system, which can be exploited in materials science and organic electronics. Safety precautions should be taken when handling this compound, as with many brominated organic substances, due to potential toxicity and environmental concerns.
Formula:C6H5BrOS
InChI:InChI=1/C6H5BrOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3
SMILES:CC(=O)c1c(ccs1)Br
Synonyms:- 1-(3-Bromothiophen-2-Yl)Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Acetyl-3-bromothiophene
CAS:Formula:C6H5BrOSPurity:96%Color and Shape:SolidMolecular weight:205.07232-Acetyl-3-bromothiophene
CAS:Formula:C6H5BrOSPurity:98%Color and Shape:Liquid, No data available.Molecular weight:205.072-Acetyl-3-bromothiophene
CAS:2-Acetyl-3-bromothiophene is a dihedral molecule that has been shown to have photovoltaic properties. The molecule has two primary amines, which function as electron donors and an interleukin, which functions as an electron acceptor. 2-Acetyl-3-bromothiophene also has a chalcone group, a carbonyl group, and yields of primary alcohols. In the experimentally determined vibration frequencies, the most intense peaks were found at 1760 cm−1 (vibrational) and 1128 cm−1 (rotational).Formula:C6H5BrOSPurity:Min. 95%Molecular weight:205.07 g/mol



