CAS 42878-53-5

1,2,3,4-tetrahydroacridine-9-carboxamide

Description:

1,2,3,4-Tetrahydroacridine-9-carboxamide is a chemical compound characterized by its bicyclic structure, which includes a tetrahydroacridine moiety and a carboxamide functional group. This compound typically exhibits properties associated with both amides and heterocyclic compounds, such as moderate solubility in polar solvents and potential biological activity. The tetrahydroacridine structure can influence its interaction with biological targets, making it of interest in medicinal chemistry, particularly in the development of drugs for neurodegenerative diseases. The presence of the carboxamide group may enhance hydrogen bonding capabilities, affecting its pharmacokinetics and pharmacodynamics. Additionally, this compound may exhibit specific reactivity patterns typical of amides, such as susceptibility to hydrolysis under certain conditions. Overall, 1,2,3,4-tetrahydroacridine-9-carboxamide represents a versatile scaffold for further chemical modifications and investigations into its therapeutic potential.

Formula: C₁₄H₁₄N₂O

InChI: InChI=1/C14H14N2O/c15-14(17)13-9-5-1-3-7-11(9)16-12-8-4-2-6-10(12)13/h1,3,5,7H,2,4,6,8H2,(H2,15,17)

SMILES: c1ccc2c(c1)c(c1CCCCc1n2)C(=O)N

Synonyms:

• 1,2,3,4-Tetrahydro-acridine-9-carboxylic acid amide

1,2,3,4-Tetrahydroacridine-9-carboxamide

CAS: 42878-53-5

Versatile small molecule scaffold

Formula: C₁₄H₁₄N₂O

Purity: Min. 95%

Molecular weight: 226.27 g/mol

Ref: 3D-SBA87853