CAS 428845-73-2

2,5-dimethyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine

Description:

2,5-Dimethyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine framework. This compound features two methyl groups at the 2 and 5 positions and a phenyl group at the 6 position of the pyrazolo ring, along with an amino group at the 7 position of the pyrimidine moiety. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific biological activities. Additionally, its unique arrangement of functional groups may allow for various synthetic modifications, making it a candidate for further research in drug development or as a chemical probe in biological studies.

Formula: C₁₄H₁₄N₄

InChI: InChI=1/C14H14N4/c1-9-8-12-16-10(2)13(14(15)18(12)17-9)11-6-4-3-5-7-11/h3-8H,15H2,1-2H3

SMILES: Cc1cc2nc(C)c(c3ccccc3)c(N)n2n1

Synonyms:

• 2,5-Dimethyl-6-phenyl-pyrazolo[1,5-a]pyrimidin-7-ylamine
• Pyrazolo[1,5-A]Pyrimidin-7-Amine, 2,5-Dimethyl-6-Phenyl-

2,5-Dimethyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine

CAS: 428845-73-2

2,5-Dimethyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine

Purity: 95%

Molecular weight: 238.29g/mol

Ref: 54-OR32244