CAS 428856-23-9

[1-(4-methylbenzyl)-1H-benzimidazol-2-yl]methanol

Description:

[1-(4-methylbenzyl)-1H-benzimidazol-2-yl]methanol is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a 4-methylbenzyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the benzimidazole moiety suggests possible applications in pharmaceuticals, particularly in areas related to anti-cancer or anti-inflammatory activities, as benzimidazole derivatives are known for their diverse biological properties. Additionally, the hydroxymethyl group may enhance solubility and reactivity, making it a versatile intermediate in organic synthesis. The compound's molecular interactions can be influenced by its functional groups, which may participate in hydrogen bonding and other intermolecular forces. Overall, [1-(4-methylbenzyl)-1H-benzimidazol-2-yl]methanol represents a compound of interest in both synthetic chemistry and medicinal research, warranting further investigation into its potential applications and mechanisms of action.

Formula: C₁₆H₁₆N₂O

InChI: InChI=1/C16H16N2O/c1-12-6-8-13(9-7-12)10-18-15-5-3-2-4-14(15)17-16(18)11-19/h2-9,19H,10-11H2,1H3

SMILES: Cc1ccc(cc1)Cn1c2ccccc2nc1CO

Synonyms:

• [1-(4-Methyl-benzyl)-1H-benzoimidazol-2-yl]-methanol
• 1H-Benzimidazole-2-methanol, 1-[(4-methylphenyl)methyl]-

[1-(4-Methylbenzyl)-1H-benzimidazol-2-yl]methanol

Controlled Product

CAS: 428856-23-9

Versatile small molecule scaffold

Formula: C₁₆H₁₆N₂O

Purity: Min. 95%

Molecular weight: 252.31 g/mol

Ref: 3D-DSA85623