CAS 4289-99-0
:N-Formylalanine ethyl ester
Description:
N-Formylalanine ethyl ester is an amino acid derivative characterized by the presence of a formyl group attached to the amino acid alanine, along with an ethyl ester functional group. This compound typically appears as a white to off-white solid or crystalline substance. It is soluble in polar solvents such as water and alcohols, which is common for amino acid derivatives. The presence of both the formyl and ethyl ester groups contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in peptide synthesis and as an intermediate in organic chemistry. N-Formylalanine ethyl ester can participate in reactions typical of amino acids, such as nucleophilic substitutions and condensation reactions. Additionally, it may exhibit biological activity, as many amino acid derivatives play roles in metabolic pathways. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H11NO3
InChI:InChI=1S/C6H11NO3/c1-3-10-6(9)5(2)7-4-8/h4-5H,3H2,1-2H3,(H,7,8)
InChI key:InChIKey=LWYAOXMPTVOERN-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(NC=O)C
Synonyms:- N-Formylalanine ethyl ester
- Alanine, N-formyl-, ethyl ester, DL-
- Alanine, N-formyl-, ethyl ester
- N-Formyl-DL-alanine ethyl ester
- DL-Alanine, N-formyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
