CAS 4290-13-5
:Santamarin
Description:
Santamarin, with the CAS number 4290-13-5, is a chemical compound classified as a sesquiterpene lactone. It is primarily derived from various plant species, particularly those in the Asteraceae family. Santamarin is known for its distinctive bitter taste and is often associated with certain medicinal properties. The compound exhibits anti-inflammatory and antimicrobial activities, making it of interest in pharmacological research. Its structure features a lactone ring, which contributes to its biological activity. Santamarin is typically found in low concentrations in plant extracts and may be used in traditional medicine practices. However, due to its potential toxicity at higher doses, caution is advised when considering its use. The compound's solubility characteristics can vary, often being more soluble in organic solvents than in water. Overall, Santamarin represents a fascinating area of study within natural products chemistry, with ongoing research exploring its therapeutic potential and mechanisms of action.
Formula:C15H20O3
InChI:InChI=1/C15H20O3/c1-8-4-5-11(16)15(3)7-6-10-9(2)14(17)18-13(10)12(8)15/h4,10-13,16H,2,5-7H2,1,3H3/t10-,11+,12+,13-,15-/m0/s1
InChI key:InChIKey=PLSSEPIRACGCBO-PFFFPCNUSA-N
SMILES:C[C@]12[C@@]([C@@]3([C@@](CC1)(C(=C)C(=O)O3)[H])[H])(C(C)=CC[C@H]2O)[H]
Synonyms:- (3aS,5aR,6R,9aS,9bS)-3a,4,5,5a,6,7,9a,9b-Octahydro-6-hydroxy-5a,9-dimethyl-3-methylenenaphtho[1,2-b]furan-2(3H)-one
- Balchanin
- Eudesma-3,11(13)-dien-12-oic acid, 1β,6α-dihydroxy-, γ-lactone
- Naphtho(1,2-b)furan-2(3H)-one, 3a,4,5,5a,6,7,9a,9b-octahydro-6-hydroxy-5a,9-dimethyl-3-methylene-, (3aS,5aR,6R,9aS,9bS)-
- Naphtho[1,2-b]furan-2(3H)-one, 3a,4,5,5a,6,7,9a,9b-octahydro-6-hydroxy-5a,9-dimethyl-3-methylene-, [3aS-(3aα,5aβ,6β,9aα,9bβ)]-
- Santamarin
- Santamarine
- (3aS,5aR,6R,9aS,9bS)-6-hydroxy-5a,9-dimethyl-3-methylidene-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-2-one
- (3aS,5aR,6R,9aS,9bS)-6-hydroxy-5a,9-dimethyl-3-methylene-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g]benzofuran-2-one
- (3aS)-2,3,3aβ,4,5,5a,6,7,9aβ,9bα-Decahydro-6α-hydroxy-5aα,9-dimethyl-3-methylenenaphtho[1,2-b]furan-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Santamarine
CAS:Santamarine has significant anticancer activity, can inhibit L1210 cells because of its cytotoxic,cytostatic and blocking mitosis and reducing uptake ofFormula:C15H20O3Purity:98%Color and Shape:SolidMolecular weight:248.32Santamarine
CAS:Applications Santamarine is a sesquiterpene lactone shows anticancer properties by inhibiting proliferation and inducing apoptosis.
References Mehmood, T., et al.: J. Cancer, 8, 1-11 (2017)Formula:C15H20O3Color and Shape:NeatMolecular weight:248.32Santamarine
CAS:Santamarine is a bioactive compound, specifically a sesquiterpene lactone, which is derived from marine organisms, often isolated from certain species of marine algae or fungi. Its mode of action primarily involves interfering with microbial cell membranes and metabolic pathways, resulting in the inhibition of microbial growth and replication. This compound has demonstrated significant potential in scientific research, especially for its antimicrobial and anticancer properties. It is often employed in studies aimed at understanding microbial resistance mechanisms, drug development, and exploring novel therapeutic approaches. With its marine origin, Santamarine provides insights into unique biological processes and interactions that are not typically observed with terrestrial compounds, making it a valuable subject of study in both pharmacological and biochemical research contexts.Formula:C15H20O3Purity:Min. 95%Color and Shape:PowderMolecular weight:248.32 g/mol





