
CAS 42902-52-3
:3-[(3-Methylphenyl)amino]-1,2-propanediol
Description:
3-[(3-Methylphenyl)amino]-1,2-propanediol, with the CAS number 42902-52-3, is an organic compound characterized by its structure, which includes a propanediol backbone substituted with an amino group and a 3-methylphenyl group. This compound typically exhibits properties associated with both alcohols and amines, such as the ability to form hydrogen bonds due to the hydroxyl (-OH) groups and the amine (-NH) functionality. It is likely to be a solid or viscous liquid at room temperature, depending on its purity and specific structural conformation. The presence of the aromatic ring contributes to its stability and potential for various chemical reactions, including nucleophilic substitutions. This compound may be of interest in pharmaceutical applications or as an intermediate in organic synthesis, given its functional groups that can participate in further chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H15NO2
InChI:InChI=1S/C10H15NO2/c1-8-3-2-4-9(5-8)11-6-10(13)7-12/h2-5,10-13H,6-7H2,1H3
InChI key:InChIKey=JODOBYDEHOMWRX-UHFFFAOYSA-N
SMILES:N(CC(CO)O)C1=CC(C)=CC=C1
Synonyms:- 1,2-Propanediol, 3-m-toluidino-
- 3-[(3-Methylphenyl)amino]-1,2-propanediol
- N-(2,3-Hydroxypropyl)-m-toluidine
- 1,2-Propanediol, 3-[(3-methylphenyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.