CAS 4291-13-8

2-(4-nitrophenyl)-1,3,4-oxadiazole

Description:

2-(4-Nitrophenyl)-1,3,4-oxadiazole, with the CAS number 4291-13-8, is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a nitrophenyl group at the 2-position of the oxadiazole, contributing to its chemical reactivity and potential applications. It is typically a yellow crystalline solid, exhibiting good thermal stability and solubility in organic solvents. The presence of the nitro group enhances its electron-withdrawing properties, making it useful in various chemical reactions, including those involving nucleophilic substitutions. Additionally, 2-(4-nitrophenyl)-1,3,4-oxadiazole is of interest in materials science and organic electronics due to its photophysical properties, which can be exploited in the development of fluorescent materials and sensors. Its biological activity has also been studied, indicating potential applications in pharmaceuticals. Overall, this compound serves as a versatile building block in organic synthesis and materials development.

Formula: C₈H₅N₃O₃

InChI: InChI=1/C8H5N3O3/c12-11(13)7-3-1-6(2-4-7)8-10-9-5-14-8/h1-5H

SMILES: c1cc(ccc1c1nnco1)N(=O)=O

Synonyms:

• 1,3,4-Oxadiazole, 2-(4-Nitrophenyl)-

2-(4-Nitrophenyl)-1,3,4-oxadiazole

CAS: 4291-13-8

2-(4-Nitrophenyl)-1,3,4-oxadiazole

Purity: ≥95%

Molecular weight: 191.14g/mol

Ref: 54-OR2119

2-(4-nitrophenyl)-1,3,4-oxadiazole

CAS: 4291-13-8

Formula: C₈H₅N₃O₃

Purity: 95%

Molecular weight: 191.146

Ref: 10-F373344