CAS 42916-73-4
:1-[1,1′-Biphenyl]-4-yl-1-pentanone
Description:
1-[1,1′-Biphenyl]-4-yl-1-pentanone, with the CAS number 42916-73-4, is an organic compound characterized by its biphenyl structure and a ketone functional group. This compound features a pentanone chain, which contributes to its hydrophobic properties. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the biphenyl moiety enhances its stability and may influence its solubility in organic solvents. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. Its chemical behavior is influenced by the ketone group, which can participate in reactions such as nucleophilic addition and condensation. Additionally, the compound's physical properties, such as boiling point and melting point, are determined by its molecular weight and structure. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C17H18O
InChI:InChI=1S/C17H18O/c1-2-3-9-17(18)16-12-10-15(11-13-16)14-7-5-4-6-8-14/h4-8,10-13H,2-3,9H2,1H3
InChI key:InChIKey=JXQDHVJDFYUJOK-UHFFFAOYSA-N
SMILES:C(CCCC)(=O)C1=CC=C(C=C1)C2=CC=CC=C2
Synonyms:- 4-Valerylbiphenyl
- p-Phenylvalerophenone
- 1-[1,1′-Biphenyl]-4-yl-1-pentanone
- 4-Pentanoylbiphenyl
- 1-Pentanone, 1-[1,1′-biphenyl]-4-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
