CAS 42918-89-8

N-[(benzyloxy)carbonyl]-D-norvaline

Description:

N-[(benzyloxy)carbonyl]-D-norvaline, with the CAS number 42918-89-8, is a synthetic amino acid derivative characterized by its unique structure, which includes a benzyloxycarbonyl (Z) protecting group attached to the amino group of D-norvaline. This compound is typically used in peptide synthesis and as an intermediate in the preparation of various bioactive molecules. Its molecular structure contributes to its stability and solubility in organic solvents, making it suitable for various chemical reactions. The presence of the benzyloxycarbonyl group enhances the compound's reactivity, allowing for selective modifications during synthesis. Additionally, D-norvaline itself is a non-proteinogenic amino acid, which can influence biological processes, particularly in the context of metabolic pathways. The compound's characteristics, including its melting point, solubility, and reactivity, are essential for its application in research and pharmaceutical development. Overall, N-[(benzyloxy)carbonyl]-D-norvaline serves as a valuable tool in organic chemistry and biochemistry.

Formula: C₁₃H₁₇NO₄

InChI: InChI=1/C13H17NO4/c1-2-6-11(12(15)16)14-13(17)18-9-10-7-4-3-5-8-10/h3-5,7-8,11H,2,6,9H2,1H3,(H,14,17)(H,15,16)/t11-/m1/s1

SMILES: CCC[C@H](C(=O)O)N=C(O)OCc1ccccc1

Synonyms:

• (2R)-2-{[(Benzyloxy)carbonyl]amino}pentanoic acid
• D-norvaline, N-[(phenylmethoxy)carbonyl]-
• Cbz-D-norvaline
• Z-D-Nva-OH
• N-[(Benzyloxy)carbonyl]-D-norvaline

Z-D-NVA-OH

CAS: 42918-89-8

Formula: C₁₃H₁₇NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 251.2784

Ref: IN-DA00C5PR

N-Cbz-D-Norvaline

CAS: 42918-89-8

N-Cbz-D-Norvaline

Purity: 98%

Molecular weight: 251.28g/mol

Ref: 54-OR1014321

N-[(BENZYLOXY)CARBONYL]-D-NORVALINE

CAS: 42918-89-8

Formula: C₁₃H₁₇NO₄

Purity: 98%

Molecular weight: 251.282

Ref: 10-F390256