CAS 42923-79-5: 1,2,3,4-Tetrahydro-7-nitroisoquinoline

Description:1,2,3,4-Tetrahydro-7-nitroisoquinoline is a bicyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a nitro group at the 7-position contributes to its reactivity and potential biological activity. This compound is typically a pale yellow solid and is soluble in organic solvents, reflecting its non-polar characteristics. It is of interest in medicinal chemistry due to its potential pharmacological properties, including effects on the central nervous system. The tetrahydro configuration indicates that it has undergone partial hydrogenation, which can influence its chemical reactivity and interaction with biological targets. Additionally, the compound may exhibit various functional properties, such as acting as a ligand in coordination chemistry or serving as a precursor in synthetic organic chemistry. Safety and handling precautions should be observed, as nitro compounds can be sensitive and potentially hazardous. Overall, 1,2,3,4-Tetrahydro-7-nitroisoquinoline represents a versatile structure with implications in both research and application.

Formula:C₉H₁₀N₂O₂

InChI:InChI=1S/C9H10N2O2/c12-11(13)9-2-1-7-3-4-10-6-8(7)5-9/h1-2,5,10H,3-4,6H2

InChI key:InChIKey=YPRWYZSUBZXORL-UHFFFAOYSA-N

SMILES:O=N(=O)C1=CC=C2C(=C1)CNCC2

Synonyms:
1,2,3,4-Tetrahydro-7-nitroisoquinoline
Isoquinoline, 1,2,3,4-tetrahydro-7-nitro-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
7-NITRO-1,2,3,4-TETRAHYDRO-ISOQUINOLINE REF: IN-DA00BYW2CAS: 42923-79-5	97%	26.00 €~259.00 €	Thu 17 Apr 25
1,2,3,4-Tetrahydro-7-nitroisoquinoline REF: 54-OR300086CAS: 42923-79-5	97%	32.00 €~1,218.00 €	Mon 21 Apr 25
7-Nitro-1,2,3,4-tetrahydroisoquinoline REF: 10-F078875CAS: 42923-79-5	95.0%	27.00 €~253.00 €	Tue 22 Apr 25
7-Nitro-1,2,3,4-tetrahydroisoquinoline REF: 3D-FN32284CAS: 42923-79-5	Min. 95%	- - -	Discontinued product