CAS 42926-52-3: 2-Ethoxybenzoyl chloride
Description:2-Ethoxybenzoyl chloride, with the CAS number 42926-52-3, is an organic compound characterized by its functional groups, including an acyl chloride and an ether. It features a benzene ring substituted with an ethoxy group and a carbonyl chloride group, which contributes to its reactivity. This compound typically appears as a colorless to pale yellow liquid and has a distinctive aromatic odor. It is known for its role as an acylating agent in organic synthesis, particularly in the preparation of various esters and amides. Due to the presence of the acyl chloride functional group, 2-ethoxybenzoyl chloride is highly reactive, especially towards nucleophiles, and can undergo hydrolysis in the presence of water, forming the corresponding carboxylic acid. Safety precautions are essential when handling this compound, as it can be corrosive and irritating to the skin, eyes, and respiratory system. Proper storage in a cool, dry place, away from moisture and incompatible substances, is also crucial to maintain its stability and prevent unwanted reactions.
Formula:C9H9ClO2
InChI:InChI=1S/C9H9ClO2/c1-2-12-8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3
InChI key:InChIKey=MDKAAWDKKBFSTK-UHFFFAOYSA-N
SMILES:O=C(Cl)C=1C=CC=CC1OCC
- Synonyms:
- 2-Ethoxybenzoyl Chloride
- Benzoyl chloride, 2-ethoxy-
- Benzoyl chloride, o-ethoxy-
- o-Ethoxybenzoyl chloride
