CAS 4294-95-5
:2-Amino-4-methoxybenzoic acid
Description:
2-Amino-4-methoxybenzoic acid, also known as p-amino-methoxybenzoic acid, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2) and a methoxy group (-OCH3) attached to a benzoic acid structure. Its molecular formula is C9H11NO3, indicating it contains nine carbon atoms, eleven hydrogen atoms, one nitrogen atom, and three oxygen atoms. This compound typically appears as a white to off-white crystalline solid and is soluble in water and organic solvents, reflecting its polar nature due to the functional groups present. It exhibits properties such as being a weak acid, with a pKa that allows it to exist in both protonated and deprotonated forms depending on the pH of the solution. 2-Amino-4-methoxybenzoic acid is of interest in various fields, including pharmaceuticals and biochemistry, where it may serve as an intermediate in the synthesis of other compounds or as a potential therapeutic agent. Its safety and handling should be approached with standard laboratory precautions.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4H,9H2,1H3,(H,10,11)
SMILES:COc1ccc(c(c1)N)C(=O)O
Synonyms:- 4-Methoxyanthranilic acid
- 2-Amino-4-Methoxy-Benzoic Acid
- 4-METHOXY-2-AMINO-BENZOIC ACID
- 2-AMINO-4-METHOXYBENZOIC ACID---OFF-WHITE POWDER, 99%---
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Amino-4-methoxybenzoic Acid
CAS:Formula:C8H9NO3Purity:>97.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:167.162-Amino-4-methoxybenzoic acid, 94%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H9NO3Purity:94%Color and Shape:Powder, Yellow or pale brown to brownMolecular weight:167.162-Amino-4-methoxybenzoic acid
CAS:Formula:C8H9NO3Purity:97%Color and Shape:SolidMolecular weight:167.16202-Amino-4-methoxybenzoic acid
CAS:Formula:C8H9NO3Purity:≥ 98.0%Color and Shape:White to light-yellow to light-orange powder to crystalsMolecular weight:167.162-Amino-4-methoxybenzoic acid
CAS:2-Amino-4-methoxybenzoic acidFormula:C8H9NO3Purity:≥95%Color and Shape: white to yellow solidMolecular weight:167.16g/mol2-Amino-4-methoxybenzoic acid
CAS:2-Amino-4-methoxybenzoic acid is a monophenolic compound that has been shown to have antioxidant properties. It is a redox potential with a pK of 7.8 and can be protonated at the phenolic hydroxyl group. 2-Amino-4-methoxybenzoic acid has been shown to inhibit the enzyme activities of histone proteins, which are enzymes that catalyze the formation of DNA from RNA. This compound also inhibits enzymes involved in amino acid synthesis such as anthranilate synthase and malic enzyme, as well as other enzymes such as phosphotransferase (PTS) and pyruvate kinase. 2-Amino-4-methoxybenzoic acid also causes inhibition of growth in phytophthora megasperma, an oomycete plant pathogen, by altering the redox potentials inside the cell membrane. The mechanism forFormula:C8H9NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:167.16 g/mol2-Amino-4-methoxybenzoic Acid
CAS:Controlled ProductApplications 2-Amino-4-methoxybenzoic Acid, is an organic building block used in the synthesis of various chemical compounds.
Formula:C8H9NO3Color and Shape:NeatMolecular weight:167.162







