CAS 42940-56-7
:7,9-Dioxo-8-azaspiro[4.5]decane-6,10-dicarbonitrile
Description:
7,9-Dioxo-8-azaspiro[4.5]decane-6,10-dicarbonitrile is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in a bicyclic framework. This compound features two carbonitrile functional groups, contributing to its potential reactivity and applications in organic synthesis. The presence of dioxo groups indicates that it has two carbonyl functionalities, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The spiro structure often imparts interesting conformational properties and can influence the compound's biological activity. The compound's CAS number, 42940-56-7, allows for its identification in chemical databases and literature. While specific physical properties such as melting point, boiling point, and solubility may vary, compounds of this type are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Overall, 7,9-Dioxo-8-azaspiro[4.5]decane-6,10-dicarbonitrile represents a complex and potentially versatile molecule in the field of chemistry.
Formula:C11H11N3O2
InChI:InChI=1S/C11H11N3O2/c12-5-7-9(15)14-10(16)8(6-13)11(7)3-1-2-4-11/h7-8H,1-4H2,(H,14,15,16)
InChI key:InChIKey=USIMPDHJLHKMKA-UHFFFAOYSA-N
SMILES:C(#N)C1C2(C(C#N)C(=O)NC1=O)CCCC2
Synonyms:- 7,9-Dioxo-8-Azaspiro[4.5]Decane-6,10-Dicarbonitrile
- 7,9-Dioxo-8-azaspiro[4.5]decane-6,10-dicarbonitrile,mixture of () and meso
- 8-Azaspiro[4.5]decane-6,10-dicarbonitrile, 7,9-dioxo-
- NSC 400097
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

