CAS 42943-68-0

[(4-bromo-2-methylphenyl)sulfanyl]acetic acid

Description:

[(4-bromo-2-methylphenyl)sulfanyl]acetic acid is an organic compound characterized by the presence of a sulfanyl (thioether) group and an acetic acid functional group. The compound features a phenyl ring substituted with a bromine atom at the para position and a methyl group at the ortho position relative to the sulfanyl group. This structure contributes to its unique chemical properties, including potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The sulfanyl group can also engage in various chemical reactions, such as oxidation or substitution. The acetic acid moiety provides acidic characteristics, allowing the compound to act as a weak acid in solution. The compound's solubility and reactivity may be influenced by the presence of the bromine and methyl substituents, which can affect its steric and electronic properties. Overall, [(4-bromo-2-methylphenyl)sulfanyl]acetic acid is of interest in organic synthesis and medicinal chemistry due to its potential biological activity and functional versatility.

Formula: C₉H₉BrO₂S

InChI: InChI=1/C9H9BrO2S/c1-6-4-7(10)2-3-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12)

SMILES: Cc1cc(ccc1SCC(=O)O)Br

Synonyms:

• (4-Bromo-2-methyl-phenylsulfanyl)-acetic acid